C14H29N — CID 115846256
1-cyclopentyl-N,5-dimethylheptan-3-amine (PubChem CID 115846256) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 1-cyclopentyl-N,5-dimethylheptan-3-amine.
| Compound Name | 1-cyclopentyl-N,5-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 115846256 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1-cyclopentyl-N,5-dimethylheptan-3-amine |
| SMILES | CCC(C)CC(CCC1CCCC1)NC |
| InChI | InChI=1S/C14H29N/c1-4-12(2)11-14(15-3)10-9-13-7-5-6-8-13/h12-15H,4-11H2,1-3H3 |
| InChIKey | DGZCEYBLMWAJDW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |