About 3-ethylhexylcyclopentane
3-ethylhexylcyclopentane (PubChem CID 123372890) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 3-ethylhexylcyclopentane.
Molecular Properties
| Compound Name | 3-ethylhexylcyclopentane |
| PubChem CID | 123372890 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 3-ethylhexylcyclopentane |
| SMILES | CCCC(CC)CCC1CCCC1 |
| InChI | InChI=1S/C13H26/c1-3-7-12(4-2)10-11-13-8-5-6-9-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | XVFDZVOYCQXWDI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethylhexylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexylcyclopentane?
The IUPAC name of 3-ethylhexylcyclopentane (CID 123372890) is 3-ethylhexylcyclopentane.
What is the SMILES notation for 3-ethylhexylcyclopentane?
The canonical SMILES for 3-ethylhexylcyclopentane is CCCC(CC)CCC1CCCC1.
What is the InChIKey of 3-ethylhexylcyclopentane?
The InChIKey is XVFDZVOYCQXWDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-3-7-12(4-2)10-11-13-8-5-6-9-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 3-ethylhexylcyclopentane?
3-ethylhexylcyclopentane has a molecular weight of 182.35 g/mol, XLogP of 4.78, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexylcyclopentane is sourced from PubChem (CID 123372890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).