About ethane;ethylcyclobutane;3-ethylhexane
ethane;ethylcyclobutane;3-ethylhexane (PubChem CID 143637843) has the molecular formula C16H36
and a molecular weight of 228.46 g/mol. Its IUPAC name is ethane;ethylcyclobutane;3-ethylhexane.
Molecular Properties
| Compound Name | ethane;ethylcyclobutane;3-ethylhexane |
| PubChem CID | 143637843 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | ethane;ethylcyclobutane;3-ethylhexane |
| SMILES | CC.CCC1CCC1.CCCC(CC)CC |
| InChI | InChI=1S/C8H18.C6H12.C2H6/c1-4-7-8(5-2)6-3;1-2-6-4-3-5-6;1-2/h8H,4-7H2,1-3H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | VZBCBYZLECMSGY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;ethylcyclobutane;3-ethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylcyclobutane;3-ethylhexane?
The IUPAC name of ethane;ethylcyclobutane;3-ethylhexane (CID 143637843) is ethane;ethylcyclobutane;3-ethylhexane.
What is the SMILES notation for ethane;ethylcyclobutane;3-ethylhexane?
The canonical SMILES for ethane;ethylcyclobutane;3-ethylhexane is CC.CCC1CCC1.CCCC(CC)CC.
What is the InChIKey of ethane;ethylcyclobutane;3-ethylhexane?
The InChIKey is VZBCBYZLECMSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C6H12.C2H6/c1-4-7-8(5-2)6-3;1-2-6-4-3-5-6;1-2/h8H,4-7H2,1-3H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;ethylcyclobutane;3-ethylhexane?
ethane;ethylcyclobutane;3-ethylhexane has a molecular weight of 228.46 g/mol, XLogP of 6.45, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylcyclobutane;3-ethylhexane is sourced from PubChem (CID 143637843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).