C12H25N — CID 105000765
N,4-diethyloct-1-en-3-amine (PubChem CID 105000765) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is N,4-diethyloct-1-en-3-amine.
| Compound Name | N,4-diethyloct-1-en-3-amine |
|---|---|
| PubChem CID | 105000765 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N,4-diethyloct-1-en-3-amine |
| SMILES | C=CC(NCC)C(CC)CCCC |
| InChI | InChI=1S/C12H25N/c1-5-9-10-11(6-2)12(7-3)13-8-4/h7,11-13H,3,5-6,8-10H2,1-2,4H3 |
| InChIKey | SLQVKJPOTIJNRR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|