C16H18N4S — CID 105169186
N-ethyl-1-(1-phenylpyrazol-4-yl)-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 105169186) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-ethyl-1-(1-phenylpyrazol-4-yl)-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-ethyl-1-(1-phenylpyrazol-4-yl)-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 105169186 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-ethyl-1-(1-phenylpyrazol-4-yl)-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | CCNC(Cc1nccs1)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N4S/c1-2-17-15(10-16-18-8-9-21-16)13-11-19-20(12-13)14-6-4-3-5-7-14/h3-9,11-12,15,17H,2,10H2,1H3 |
| InChIKey | NFSLDUKPCTUGGF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |