C17H18N2O2 — CID 10517014
(3R,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxamide (PubChem CID 10517014) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3R,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxamide.
| Compound Name | (3R,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 10517014 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (3R,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxamide |
| SMILES | C[C@@H]1ON(c2ccccc2)[C@@H](c2ccccc2)[C@H]1C(N)=O |
| InChI | InChI=1S/C17H18N2O2/c1-12-15(17(18)20)16(13-8-4-2-5-9-13)19(21-12)14-10-6-3-7-11-14/h2-12,15-16H,1H3,(H2,18,20)/t12-,15-,16-/m0/s1 |
| InChIKey | OBVOOMDYWDFPBF-RCBQFDQVSA-N |
| XLogP | 2.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |