C17H26N2OS — CID 105170881
1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-3-pyridin-3-ylpropan-1-amine (PubChem CID 105170881) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 105170881 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-3-pyridin-3-ylpropan-1-amine |
| SMILES | NC(CCc1cccnc1)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C17H26N2OS/c18-16(4-3-14-2-1-8-19-13-14)15-5-9-20-17(12-15)6-10-21-11-7-17/h1-2,8,13,15-16H,3-7,9-12,18H2 |
| InChIKey | CKBDMODSXPVWJG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |