C17H27NOS2 — CID 105170846
1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-4-thiophen-2-ylbutan-1-amine (PubChem CID 105170846) has the molecular formula C17H27NOS2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 105170846 |
| Molecular Formula | C17H27NOS2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-4-thiophen-2-ylbutan-1-amine |
| SMILES | NC(CCCc1cccs1)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C17H27NOS2/c18-16(5-1-3-15-4-2-10-21-15)14-6-9-19-17(13-14)7-11-20-12-8-17/h2,4,10,14,16H,1,3,5-9,11-13,18H2 |
| InChIKey | VQMKOVYKTFPBCX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |