C15H18BrF4N — CID 105172197
2-(2-bromo-3-fluorophenyl)-1-[4-(trifluoromethyl)cyclohexyl]ethanamine (PubChem CID 105172197) has the molecular formula C15H18BrF4N and a molecular weight of 368.21 g/mol. Its IUPAC name is 2-(2-bromo-3-fluorophenyl)-1-[4-(trifluoromethyl)cyclohexyl]ethanamine.
| Compound Name | 2-(2-bromo-3-fluorophenyl)-1-[4-(trifluoromethyl)cyclohexyl]ethanamine |
|---|---|
| PubChem CID | 105172197 |
| Molecular Formula | C15H18BrF4N |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(2-bromo-3-fluorophenyl)-1-[4-(trifluoromethyl)cyclohexyl]ethanamine |
| SMILES | NC(Cc1cccc(F)c1Br)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18BrF4N/c16-14-10(2-1-3-12(14)17)8-13(21)9-4-6-11(7-5-9)15(18,19)20/h1-3,9,11,13H,4-8,21H2 |
| InChIKey | JATSCQYLWUOVTA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |