C18H25BrFN — CID 105020628
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanamine (PubChem CID 105020628) has the molecular formula C18H25BrFN and a molecular weight of 354.31 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanamine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105020628 |
| Molecular Formula | C18H25BrFN |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanamine |
| SMILES | NC(Cc1cccc(F)c1Br)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H25BrFN/c19-18-15(6-3-7-16(18)20)11-17(21)14-9-8-12-4-1-2-5-13(12)10-14/h3,6-7,12-14,17H,1-2,4-5,8-11,21H2 |
| InChIKey | PYRZDKMMZLVREU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |