C18H24BrFO — CID 115826409
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanol (PubChem CID 115826409) has the molecular formula C18H24BrFO and a molecular weight of 355.29 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanol.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 115826409 |
| Molecular Formula | C18H24BrFO |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2-bromo-3-fluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(F)c1Br)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H24BrFO/c19-18-15(6-3-7-16(18)20)11-17(21)14-9-8-12-4-1-2-5-13(12)10-14/h3,6-7,12-14,17,21H,1-2,4-5,8-11H2 |
| InChIKey | ZTCUSKUCOXGYLG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |