C16H18N4 — CID 105172503
quinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanamine (PubChem CID 105172503) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is quinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanamine.
| Compound Name | quinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105172503 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | quinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanamine |
| SMILES | Cc1nn(C)c(C)c1C(N)c1cccc2cccnc12 |
| InChI | InChI=1S/C16H18N4/c1-10-14(11(2)20(3)19-10)15(17)13-8-4-6-12-7-5-9-18-16(12)13/h4-9,15H,17H2,1-3H3 |
| InChIKey | XXWWVEDAWZQWBP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |