C16H23N3O2 — CID 105180506
[2-(2-methoxyethoxy)phenyl]-(1,3,5-trimethylpyrazol-4-yl)methanamine (PubChem CID 105180506) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [2-(2-methoxyethoxy)phenyl]-(1,3,5-trimethylpyrazol-4-yl)methanamine.
| Compound Name | [2-(2-methoxyethoxy)phenyl]-(1,3,5-trimethylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105180506 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [2-(2-methoxyethoxy)phenyl]-(1,3,5-trimethylpyrazol-4-yl)methanamine |
| SMILES | COCCOc1ccccc1C(N)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H23N3O2/c1-11-15(12(2)19(3)18-11)16(17)13-7-5-6-8-14(13)21-10-9-20-4/h5-8,16H,9-10,17H2,1-4H3 |
| InChIKey | KIXYZRBKZYAPGR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|