C16H18N4S — CID 105172648
N-[(4-methylthiadiazol-5-yl)-quinolin-7-ylmethyl]propan-1-amine (PubChem CID 105172648) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[(4-methylthiadiazol-5-yl)-quinolin-7-ylmethyl]propan-1-amine.
| Compound Name | N-[(4-methylthiadiazol-5-yl)-quinolin-7-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 105172648 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[(4-methylthiadiazol-5-yl)-quinolin-7-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccc2cccnc2c1)c1snnc1C |
| InChI | InChI=1S/C16H18N4S/c1-3-8-18-15(16-11(2)19-20-21-16)13-7-6-12-5-4-9-17-14(12)10-13/h4-7,9-10,15,18H,3,8H2,1-2H3 |
| InChIKey | WQJWVEANFVATMY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |