C17H18N2O — CID 81231383
N-[furan-2-yl(quinolin-7-yl)methyl]propan-1-amine (PubChem CID 81231383) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[furan-2-yl(quinolin-7-yl)methyl]propan-1-amine.
| Compound Name | N-[furan-2-yl(quinolin-7-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81231383 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[furan-2-yl(quinolin-7-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc2cccnc2c1)c1ccco1 |
| InChI | InChI=1S/C17H18N2O/c1-2-9-19-17(16-6-4-11-20-16)14-8-7-13-5-3-10-18-15(13)12-14/h3-8,10-12,17,19H,2,9H2,1H3 |
| InChIKey | NVAWUUVELVLHCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |