C14H20ClNO3 — CID 10517282
(E)-1-(4-chlorophenyl)-N-(2,2-diethoxyethoxy)ethanimine (PubChem CID 10517282) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N-(2,2-diethoxyethoxy)ethanimine.
| Compound Name | (E)-1-(4-chlorophenyl)-N-(2,2-diethoxyethoxy)ethanimine |
|---|---|
| PubChem CID | 10517282 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N-(2,2-diethoxyethoxy)ethanimine |
| SMILES | CCOC(CO/N=C(\C)c1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C14H20ClNO3/c1-4-17-14(18-5-2)10-19-16-11(3)12-6-8-13(15)9-7-12/h6-9,14H,4-5,10H2,1-3H3/b16-11+ |
| InChIKey | FLYCYBFDGHUDMK-LFIBNONCSA-N |
| XLogP | 3.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|