C15H23NO3 — CID 10706817
(E)-N-(2,2-diethoxyethoxy)-1-phenylpropan-1-imine (PubChem CID 10706817) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (E)-N-(2,2-diethoxyethoxy)-1-phenylpropan-1-imine.
| Compound Name | (E)-N-(2,2-diethoxyethoxy)-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 10706817 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (E)-N-(2,2-diethoxyethoxy)-1-phenylpropan-1-imine |
| SMILES | CCOC(CO/N=C(\CC)c1ccccc1)OCC |
| InChI | InChI=1S/C15H23NO3/c1-4-14(13-10-8-7-9-11-13)16-19-12-15(17-5-2)18-6-3/h7-11,15H,4-6,12H2,1-3H3/b16-14+ |
| InChIKey | IINCVRYYEQHLFF-JQIJEIRASA-N |
| XLogP | 3.22 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|