C13H18ClN3S2 — CID 105173463
N-[(5-chlorothiophen-2-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine (PubChem CID 105173463) has the molecular formula C13H18ClN3S2 and a molecular weight of 315.90 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105173463 |
| Molecular Formula | C13H18ClN3S2 |
| Molecular Weight | 315.90 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)s1)c1snnc1CCC |
| InChI | InChI=1S/C13H18ClN3S2/c1-3-5-9-13(19-17-16-9)12(15-8-4-2)10-6-7-11(14)18-10/h6-7,12,15H,3-5,8H2,1-2H3 |
| InChIKey | SOBDFUDGVLJXOH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |