C12H19BrN6S — CID 106464936
N-[(5-bromo-3-methyltriazol-4-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine (PubChem CID 106464936) has the molecular formula C12H19BrN6S and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106464936 |
| Molecular Formula | C12H19BrN6S |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(4-propylthiadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1snnc1CCC)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H19BrN6S/c1-4-6-8-11(20-18-15-8)9(14-7-5-2)10-12(13)16-17-19(10)3/h9,14H,4-7H2,1-3H3 |
| InChIKey | RZVNXQGPUIPTEN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |