C12H18BrN5S — CID 105189704
N-[(4-bromo-1-methylpyrazol-5-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine (PubChem CID 105189704) has the molecular formula C12H18BrN5S and a molecular weight of 344.28 g/mol. Its IUPAC name is N-[(4-bromo-1-methylpyrazol-5-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-1-methylpyrazol-5-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105189704 |
| Molecular Formula | C12H18BrN5S |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[(4-bromo-1-methylpyrazol-5-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine |
| SMILES | CCCc1nnsc1C(NCC)c1c(Br)cnn1C |
| InChI | InChI=1S/C12H18BrN5S/c1-4-6-9-12(19-17-16-9)10(14-5-2)11-8(13)7-15-18(11)3/h7,10,14H,4-6H2,1-3H3 |
| InChIKey | NXSOAWLEQJKWNH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |