C11H20BrN3 — CID 114657465
1-(4-bromo-1-methylpyrazol-5-yl)-N-ethylpentan-1-amine (PubChem CID 114657465) has the molecular formula C11H20BrN3 and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-N-ethylpentan-1-amine.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-N-ethylpentan-1-amine |
|---|---|
| PubChem CID | 114657465 |
| Molecular Formula | C11H20BrN3 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-N-ethylpentan-1-amine |
| SMILES | CCCCC(NCC)c1c(Br)cnn1C |
| InChI | InChI=1S/C11H20BrN3/c1-4-6-7-10(13-5-2)11-9(12)8-14-15(11)3/h8,10,13H,4-7H2,1-3H3 |
| InChIKey | RZYXUOBKOZTZFG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |