C12H19NO5S — CID 10517536
5-O-ethyl 3-O-methyl (2S,3S,4S,5S)-2-hydroxy-2,4-dimethyl-6-sulfanylidenepiperidine-3,5-dicarboxylate (PubChem CID 10517536) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl (2S,3S,4S,5S)-2-hydroxy-2,4-dimethyl-6-sulfanylidenepiperidine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl (2S,3S,4S,5S)-2-hydroxy-2,4-dimethyl-6-sulfanylidenepiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10517536 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-O-ethyl 3-O-methyl (2S,3S,4S,5S)-2-hydroxy-2,4-dimethyl-6-sulfanylidenepiperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C(=S)N[C@@](C)(O)[C@@H](C(=O)OC)[C@@H]1C |
| InChI | InChI=1S/C12H19NO5S/c1-5-18-10(14)7-6(2)8(11(15)17-4)12(3,16)13-9(7)19/h6-8,16H,5H2,1-4H3,(H,13,19)/t6-,7-,8-,12+/m1/s1 |
| InChIKey | JNPZZXPJHVTVDT-ASSXTNMASA-N |
| XLogP | 0.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|