C16H28N2O2 — CID 105176094
N-ethyl-2-[(2-methylpropan-2-yl)oxy]-1-(5-propan-2-yloxy-3-pyridinyl)ethanamine (PubChem CID 105176094) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-ethyl-2-[(2-methylpropan-2-yl)oxy]-1-(5-propan-2-yloxy-3-pyridinyl)ethanamine.
| Compound Name | N-ethyl-2-[(2-methylpropan-2-yl)oxy]-1-(5-propan-2-yloxy-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 105176094 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-ethyl-2-[(2-methylpropan-2-yl)oxy]-1-(5-propan-2-yloxy-3-pyridinyl)ethanamine |
| SMILES | CCNC(COC(C)(C)C)c1cncc(OC(C)C)c1 |
| InChI | InChI=1S/C16H28N2O2/c1-7-18-15(11-19-16(4,5)6)13-8-14(10-17-9-13)20-12(2)3/h8-10,12,15,18H,7,11H2,1-6H3 |
| InChIKey | YAFZEHWGDLQTII-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |