C16H28N2 — CID 105176845
N,5-diethyl-1-pyridin-4-ylheptan-3-amine (PubChem CID 105176845) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N,5-diethyl-1-pyridin-4-ylheptan-3-amine.
| Compound Name | N,5-diethyl-1-pyridin-4-ylheptan-3-amine |
|---|---|
| PubChem CID | 105176845 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N,5-diethyl-1-pyridin-4-ylheptan-3-amine |
| SMILES | CCNC(CCc1ccncc1)CC(CC)CC |
| InChI | InChI=1S/C16H28N2/c1-4-14(5-2)13-16(18-6-3)8-7-15-9-11-17-12-10-15/h9-12,14,16,18H,4-8,13H2,1-3H3 |
| InChIKey | OVCGNSCRUPHAFC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |