C18H31N — CID 105176885
N,5-diethyl-1-(2-methylphenyl)heptan-3-amine (PubChem CID 105176885) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is N,5-diethyl-1-(2-methylphenyl)heptan-3-amine.
| Compound Name | N,5-diethyl-1-(2-methylphenyl)heptan-3-amine |
|---|---|
| PubChem CID | 105176885 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N,5-diethyl-1-(2-methylphenyl)heptan-3-amine |
| SMILES | CCNC(CCc1ccccc1C)CC(CC)CC |
| InChI | InChI=1S/C18H31N/c1-5-16(6-2)14-18(19-7-3)13-12-17-11-9-8-10-15(17)4/h8-11,16,18-19H,5-7,12-14H2,1-4H3 |
| InChIKey | FTQAEPFWZSAVDL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |