C13H29NO — CID 105176889
N,4-diethyl-1-propan-2-yloxyhexan-2-amine (PubChem CID 105176889) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is N,4-diethyl-1-propan-2-yloxyhexan-2-amine.
| Compound Name | N,4-diethyl-1-propan-2-yloxyhexan-2-amine |
|---|---|
| PubChem CID | 105176889 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | N,4-diethyl-1-propan-2-yloxyhexan-2-amine |
| SMILES | CCNC(COC(C)C)CC(CC)CC |
| InChI | InChI=1S/C13H29NO/c1-6-12(7-2)9-13(14-8-3)10-15-11(4)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | GZNVREXIYMWJBO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |