C15H29N3 — CID 105177156
7-methyl-1-(1,3,5-trimethylpyrazol-4-yl)octan-3-amine (PubChem CID 105177156) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 7-methyl-1-(1,3,5-trimethylpyrazol-4-yl)octan-3-amine.
| Compound Name | 7-methyl-1-(1,3,5-trimethylpyrazol-4-yl)octan-3-amine |
|---|---|
| PubChem CID | 105177156 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 7-methyl-1-(1,3,5-trimethylpyrazol-4-yl)octan-3-amine |
| SMILES | Cc1nn(C)c(C)c1CCC(N)CCCC(C)C |
| InChI | InChI=1S/C15H29N3/c1-11(2)7-6-8-14(16)9-10-15-12(3)17-18(5)13(15)4/h11,14H,6-10,16H2,1-5H3 |
| InChIKey | ZJIQWCBBCXOUEM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |