C18H26BrNO — CID 105177238
1-(7-bromo-1-benzofuran-2-yl)-5-methyl-N-propylhexan-1-amine (PubChem CID 105177238) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-(7-bromo-1-benzofuran-2-yl)-5-methyl-N-propylhexan-1-amine.
| Compound Name | 1-(7-bromo-1-benzofuran-2-yl)-5-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 105177238 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(7-bromo-1-benzofuran-2-yl)-5-methyl-N-propylhexan-1-amine |
| SMILES | CCCNC(CCCC(C)C)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C18H26BrNO/c1-4-11-20-16(10-5-7-13(2)3)17-12-14-8-6-9-15(19)18(14)21-17/h6,8-9,12-13,16,20H,4-5,7,10-11H2,1-3H3 |
| InChIKey | KUJWVLQDNPGVKY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |