C14H17Br2NO — CID 65440043
1-(5,7-dibromo-1-benzofuran-2-yl)-N-propylpropan-1-amine (PubChem CID 65440043) has the molecular formula C14H17Br2NO and a molecular weight of 375.10 g/mol. Its IUPAC name is 1-(5,7-dibromo-1-benzofuran-2-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(5,7-dibromo-1-benzofuran-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 65440043 |
| Molecular Formula | C14H17Br2NO |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 1-(5,7-dibromo-1-benzofuran-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C14H17Br2NO/c1-3-5-17-12(4-2)13-7-9-6-10(15)8-11(16)14(9)18-13/h6-8,12,17H,3-5H2,1-2H3 |
| InChIKey | ZAKPVSHVYPJNKS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |