C11H11Br2NO — CID 65440371
1-(5,7-dibromo-1-benzofuran-2-yl)-N-methylethanamine (PubChem CID 65440371) has the molecular formula C11H11Br2NO and a molecular weight of 333.02 g/mol. Its IUPAC name is 1-(5,7-dibromo-1-benzofuran-2-yl)-N-methylethanamine.
| Compound Name | 1-(5,7-dibromo-1-benzofuran-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 65440371 |
| Molecular Formula | C11H11Br2NO |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 1-(5,7-dibromo-1-benzofuran-2-yl)-N-methylethanamine |
| SMILES | CNC(C)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C11H11Br2NO/c1-6(14-2)10-4-7-3-8(12)5-9(13)11(7)15-10/h3-6,14H,1-2H3 |
| InChIKey | DPOZJBCGBPXWBN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |