C12H17F2NO — CID 105177457
1-(4,4-difluorocyclohexyl)-2-(furan-2-yl)ethanamine (PubChem CID 105177457) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(furan-2-yl)ethanamine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 105177457 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(furan-2-yl)ethanamine |
| SMILES | NC(Cc1ccco1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H17F2NO/c13-12(14)5-3-9(4-6-12)11(15)8-10-2-1-7-16-10/h1-2,7,9,11H,3-6,8,15H2 |
| InChIKey | AEOYSVKAJFIBNK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |