C14H18BrF2N — CID 105087726
2-(2-bromophenyl)-1-(4,4-difluorocyclohexyl)ethanamine (PubChem CID 105087726) has the molecular formula C14H18BrF2N and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-(4,4-difluorocyclohexyl)ethanamine.
| Compound Name | 2-(2-bromophenyl)-1-(4,4-difluorocyclohexyl)ethanamine |
|---|---|
| PubChem CID | 105087726 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(2-bromophenyl)-1-(4,4-difluorocyclohexyl)ethanamine |
| SMILES | NC(Cc1ccccc1Br)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H18BrF2N/c15-12-4-2-1-3-11(12)9-13(18)10-5-7-14(16,17)8-6-10/h1-4,10,13H,5-9,18H2 |
| InChIKey | CKUCCDQFXHFVSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |