C14H18F3N — CID 114215925
1-(3,3-difluorocyclohexyl)-2-(2-fluorophenyl)ethanamine (PubChem CID 114215925) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-2-(2-fluorophenyl)ethanamine.
| Compound Name | 1-(3,3-difluorocyclohexyl)-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 114215925 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-2-(2-fluorophenyl)ethanamine |
| SMILES | NC(Cc1ccccc1F)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H18F3N/c15-12-6-2-1-4-10(12)8-13(18)11-5-3-7-14(16,17)9-11/h1-2,4,6,11,13H,3,5,7-9,18H2 |
| InChIKey | HWWBIGMBASMLCC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |