C14H19NS — CID 105179531
1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)hex-5-yn-1-amine (PubChem CID 105179531) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)hex-5-yn-1-amine.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105179531 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)C1CCCc2sccc21 |
| InChI | InChI=1S/C14H19NS/c1-2-3-4-7-13(15)11-6-5-8-14-12(11)9-10-16-14/h1,9-11,13H,3-8,15H2 |
| InChIKey | OYNKHAFFRVWCMG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|