C14H20N2 — CID 105179646
N-methyl-1-pyridin-2-yloct-7-yn-3-amine (PubChem CID 105179646) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-methyl-1-pyridin-2-yloct-7-yn-3-amine.
| Compound Name | N-methyl-1-pyridin-2-yloct-7-yn-3-amine |
|---|---|
| PubChem CID | 105179646 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-methyl-1-pyridin-2-yloct-7-yn-3-amine |
| SMILES | C#CCCCC(CCc1ccccn1)NC |
| InChI | InChI=1S/C14H20N2/c1-3-4-5-8-13(15-2)10-11-14-9-6-7-12-16-14/h1,6-7,9,12-13,15H,4-5,8,10-11H2,2H3 |
| InChIKey | MEGLFYPLMLYFPB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|