C12H17N3 — CID 105307905
1-pyridin-2-ylhept-6-yn-3-ylhydrazine (PubChem CID 105307905) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-pyridin-2-ylhept-6-yn-3-ylhydrazine.
| Compound Name | 1-pyridin-2-ylhept-6-yn-3-ylhydrazine |
|---|---|
| PubChem CID | 105307905 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-pyridin-2-ylhept-6-yn-3-ylhydrazine |
| SMILES | C#CCCC(CCc1ccccn1)NN |
| InChI | InChI=1S/C12H17N3/c1-2-3-6-12(15-13)9-8-11-7-4-5-10-14-11/h1,4-5,7,10,12,15H,3,6,8-9,13H2 |
| InChIKey | ABYLFTCJGSZKMK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|