C13H21N3 — CID 105310094
(1-cyclobutyl-4-pyridin-2-ylbutan-2-yl)hydrazine (PubChem CID 105310094) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (1-cyclobutyl-4-pyridin-2-ylbutan-2-yl)hydrazine.
| Compound Name | (1-cyclobutyl-4-pyridin-2-ylbutan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105310094 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (1-cyclobutyl-4-pyridin-2-ylbutan-2-yl)hydrazine |
| SMILES | NNC(CCc1ccccn1)CC1CCC1 |
| InChI | InChI=1S/C13H21N3/c14-16-13(10-11-4-3-5-11)8-7-12-6-1-2-9-15-12/h1-2,6,9,11,13,16H,3-5,7-8,10,14H2 |
| InChIKey | WCKQOSGGWIBUAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|