C14H25N3 — CID 105298189
(5-methyl-1-pyridin-2-yloctan-3-yl)hydrazine (PubChem CID 105298189) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (5-methyl-1-pyridin-2-yloctan-3-yl)hydrazine.
| Compound Name | (5-methyl-1-pyridin-2-yloctan-3-yl)hydrazine |
|---|---|
| PubChem CID | 105298189 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (5-methyl-1-pyridin-2-yloctan-3-yl)hydrazine |
| SMILES | CCCC(C)CC(CCc1ccccn1)NN |
| InChI | InChI=1S/C14H25N3/c1-3-6-12(2)11-14(17-15)9-8-13-7-4-5-10-16-13/h4-5,7,10,12,14,17H,3,6,8-9,11,15H2,1-2H3 |
| InChIKey | PWMHCRSUQLVZPR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|