C12H18N2S — CID 105179943
1-(2-methylthiolan-2-yl)-2-pyridin-3-ylethanamine (PubChem CID 105179943) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 1-(2-methylthiolan-2-yl)-2-pyridin-3-ylethanamine.
| Compound Name | 1-(2-methylthiolan-2-yl)-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 105179943 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(2-methylthiolan-2-yl)-2-pyridin-3-ylethanamine |
| SMILES | CC1(C(N)Cc2cccnc2)CCCS1 |
| InChI | InChI=1S/C12H18N2S/c1-12(5-3-7-15-12)11(13)8-10-4-2-6-14-9-10/h2,4,6,9,11H,3,5,7-8,13H2,1H3 |
| InChIKey | VOSGIZWSVAHZAZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |