C12H18N2S — CID 104736655
N-methyl-2-pyridin-3-yl-1-(thiolan-2-yl)ethanamine (PubChem CID 104736655) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N-methyl-2-pyridin-3-yl-1-(thiolan-2-yl)ethanamine.
| Compound Name | N-methyl-2-pyridin-3-yl-1-(thiolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 104736655 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-methyl-2-pyridin-3-yl-1-(thiolan-2-yl)ethanamine |
| SMILES | CNC(Cc1cccnc1)C1CCCS1 |
| InChI | InChI=1S/C12H18N2S/c1-13-11(12-5-3-7-15-12)8-10-4-2-6-14-9-10/h2,4,6,9,11-13H,3,5,7-8H2,1H3 |
| InChIKey | QCAUIIDMPYQDOA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |