C13H21N3 — CID 107194693
[1-(2-methylcyclopentyl)-2-pyridin-3-ylethyl]hydrazine (PubChem CID 107194693) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is [1-(2-methylcyclopentyl)-2-pyridin-3-ylethyl]hydrazine.
| Compound Name | [1-(2-methylcyclopentyl)-2-pyridin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107194693 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | [1-(2-methylcyclopentyl)-2-pyridin-3-ylethyl]hydrazine |
| SMILES | CC1CCCC1C(Cc1cccnc1)NN |
| InChI | InChI=1S/C13H21N3/c1-10-4-2-6-12(10)13(16-14)8-11-5-3-7-15-9-11/h3,5,7,9-10,12-13,16H,2,4,6,8,14H2,1H3 |
| InChIKey | KAUASXOKDPRLLV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|