C15H21N — CID 57256962
3-[2,2-di(cyclobutyl)ethyl]pyridine (PubChem CID 57256962) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-[2,2-di(cyclobutyl)ethyl]pyridine.
| Compound Name | 3-[2,2-di(cyclobutyl)ethyl]pyridine |
|---|---|
| PubChem CID | 57256962 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-[2,2-di(cyclobutyl)ethyl]pyridine |
| SMILES | c1cncc(CC(C2CCC2)C2CCC2)c1 |
| InChI | InChI=1S/C15H21N/c1-5-13(6-1)15(14-7-2-8-14)10-12-4-3-9-16-11-12/h3-4,9,11,13-15H,1-2,5-8,10H2 |
| InChIKey | DWQRBLGZYWWMAI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |