C14H23N3O — CID 105333771
[2-pyridin-3-yl-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine (PubChem CID 105333771) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is [2-pyridin-3-yl-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-pyridin-3-yl-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105333771 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | [2-pyridin-3-yl-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine |
| SMILES | CC1OC(C)C(C(Cc2cccnc2)NN)C1C |
| InChI | InChI=1S/C14H23N3O/c1-9-10(2)18-11(3)14(9)13(17-15)7-12-5-4-6-16-8-12/h4-6,8-11,13-14,17H,7,15H2,1-3H3 |
| InChIKey | PDTRNKZERDWJMD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|