C15H22BrFN2O — CID 105297482
[2-(4-bromo-2-fluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine (PubChem CID 105297482) has the molecular formula C15H22BrFN2O and a molecular weight of 345.26 g/mol. Its IUPAC name is [2-(4-bromo-2-fluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-2-fluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105297482 |
| Molecular Formula | C15H22BrFN2O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [2-(4-bromo-2-fluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethyl]hydrazine |
| SMILES | CC1OC(C)C(C(Cc2ccc(Br)cc2F)NN)C1C |
| InChI | InChI=1S/C15H22BrFN2O/c1-8-9(2)20-10(3)15(8)14(19-18)6-11-4-5-12(16)7-13(11)17/h4-5,7-10,14-15,19H,6,18H2,1-3H3 |
| InChIKey | DLZDXNAZYOMIAF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|