C13H20N2O — CID 115799743
pyridin-3-yl-(2,4,5-trimethyloxolan-3-yl)methanamine (PubChem CID 115799743) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is pyridin-3-yl-(2,4,5-trimethyloxolan-3-yl)methanamine.
| Compound Name | pyridin-3-yl-(2,4,5-trimethyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 115799743 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | pyridin-3-yl-(2,4,5-trimethyloxolan-3-yl)methanamine |
| SMILES | CC1OC(C)C(C(N)c2cccnc2)C1C |
| InChI | InChI=1S/C13H20N2O/c1-8-9(2)16-10(3)12(8)13(14)11-5-4-6-15-7-11/h4-10,12-13H,14H2,1-3H3 |
| InChIKey | RDGTYWMJAURTLC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |