C14H22N2 — CID 105182482
N,6-dimethyl-1-pyridin-4-ylhept-6-en-3-amine (PubChem CID 105182482) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,6-dimethyl-1-pyridin-4-ylhept-6-en-3-amine.
| Compound Name | N,6-dimethyl-1-pyridin-4-ylhept-6-en-3-amine |
|---|---|
| PubChem CID | 105182482 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,6-dimethyl-1-pyridin-4-ylhept-6-en-3-amine |
| SMILES | C=C(C)CCC(CCc1ccncc1)NC |
| InChI | InChI=1S/C14H22N2/c1-12(2)4-6-14(15-3)7-5-13-8-10-16-11-9-13/h8-11,14-15H,1,4-7H2,2-3H3 |
| InChIKey | BPLXGRMYZXZCIC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|