C13H24ClN3O — CID 105183643
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-[(2-methylpropan-2-yl)oxy]ethanamine (PubChem CID 105183643) has the molecular formula C13H24ClN3O and a molecular weight of 273.81 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-[(2-methylpropan-2-yl)oxy]ethanamine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-[(2-methylpropan-2-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 105183643 |
| Molecular Formula | C13H24ClN3O |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-[(2-methylpropan-2-yl)oxy]ethanamine |
| SMILES | CNC(COC(C)(C)C)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C13H24ClN3O/c1-9(2)17-12(10(14)7-16-17)11(15-6)8-18-13(3,4)5/h7,9,11,15H,8H2,1-6H3 |
| InChIKey | ZXEUQDSIVLACGJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |