C12H22ClN3O — CID 105183622
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-propan-2-yloxyethanamine (PubChem CID 105183622) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-propan-2-yloxyethanamine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 105183622 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methyl-2-propan-2-yloxyethanamine |
| SMILES | CNC(COC(C)C)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C12H22ClN3O/c1-8(2)16-12(10(13)6-15-16)11(14-5)7-17-9(3)4/h6,8-9,11,14H,7H2,1-5H3 |
| InChIKey | AIAFTHMLLVGSRU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |