C13H12ClN3OS — CID 105186991
N-[(7-chloro-1-benzofuran-2-yl)-(thiadiazol-4-yl)methyl]ethanamine (PubChem CID 105186991) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is N-[(7-chloro-1-benzofuran-2-yl)-(thiadiazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(7-chloro-1-benzofuran-2-yl)-(thiadiazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105186991 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-[(7-chloro-1-benzofuran-2-yl)-(thiadiazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1csnn1)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C13H12ClN3OS/c1-2-15-12(10-7-19-17-16-10)11-6-8-4-3-5-9(14)13(8)18-11/h3-7,12,15H,2H2,1H3 |
| InChIKey | HCYUQVYHDNBBQL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |