C16H24ClNO2 — CID 105189139
2-(4-chlorophenoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine (PubChem CID 105189139) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine.
| Compound Name | 2-(4-chlorophenoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 105189139 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
| SMILES | CC1(C)CC(C(N)COc2ccc(Cl)cc2)C(C)(C)O1 |
| InChI | InChI=1S/C16H24ClNO2/c1-15(2)9-13(16(3,4)20-15)14(18)10-19-12-7-5-11(17)6-8-12/h5-8,13-14H,9-10,18H2,1-4H3 |
| InChIKey | VGTZKONPEWQUDD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |